C9H11N3OS — CID 106374484
3-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1H-imidazole-2-thione (PubChem CID 106374484) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1H-imidazole-2-thione.
| Compound Name | 3-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 106374484 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 3-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1H-imidazole-2-thione |
| SMILES | CCc1cnc(Cn2cc[nH]c2=S)o1 |
| InChI | InChI=1S/C9H11N3OS/c1-2-7-5-11-8(13-7)6-12-4-3-10-9(12)14/h3-5H,2,6H2,1H3,(H,10,14) |
| InChIKey | AUFJLODYKQPWBE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|