C16H15ClHgO2 — CID 10600620
chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury (PubChem CID 10600620) has the molecular formula C16H15ClHgO2 and a molecular weight of 475.34 g/mol. Its IUPAC name is chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury.
| Compound Name | chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury |
|---|---|
| PubChem CID | 10600620 |
| Molecular Formula | C16H15ClHgO2 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury |
| SMILES | COc1ccc(/C(=C/[Hg]Cl)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H15O2.ClH.Hg/c1-12(13-7-5-4-6-8-13)15-10-9-14(17-2)11-16(15)18-3;;/h1,4-11H,2-3H3;1H;/q;;+1/p-1 |
| InChIKey | NHKNUUSEUNIQCS-UHFFFAOYSA-M |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|