About chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury
chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury (PubChem CID 10600620) has the molecular formula C16H15ClHgO2
and a molecular weight of 475.34 g/mol. Its IUPAC name is chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury.
Molecular Properties
| Compound Name | chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury |
| PubChem CID | 10600620 |
| Molecular Formula | C16H15ClHgO2 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury |
| SMILES | COc1ccc(/C(=C/[Hg]Cl)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H15O2.ClH.Hg/c1-12(13-7-5-4-6-8-13)15-10-9-14(17-2)11-16(15)18-3;;/h1,4-11H,2-3H3;1H;/q;;+1/p-1 |
| InChIKey | NHKNUUSEUNIQCS-UHFFFAOYSA-M |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury?
The IUPAC name of chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury (CID 10600620) is chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury.
What is the SMILES notation for chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury?
The canonical SMILES for chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury is COc1ccc(/C(=C/[Hg]Cl)c2ccccc2)c(OC)c1.
What is the InChIKey of chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury?
The InChIKey is NHKNUUSEUNIQCS-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H15O2.ClH.Hg/c1-12(13-7-5-4-6-8-13)15-10-9-14(17-2)11-16(15)18-3;;/h1,4-11H,2-3H3;1H;/q;;+1/p-1.
What are the key properties of chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury?
chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury has a molecular weight of 475.34 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[(E)-2-(2,4-dimethoxyphenyl)-2-phenylethenyl]mercury is sourced from PubChem (CID 10600620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).