C21H25NO — CID 139761075
N,N-diethyl-3-methoxy-4-(1-phenylbuta-1,3-dienyl)aniline (PubChem CID 139761075) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is N,N-diethyl-3-methoxy-4-(1-phenylbuta-1,3-dienyl)aniline.
| Compound Name | N,N-diethyl-3-methoxy-4-(1-phenylbuta-1,3-dienyl)aniline |
|---|---|
| PubChem CID | 139761075 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N,N-diethyl-3-methoxy-4-(1-phenylbuta-1,3-dienyl)aniline |
| SMILES | C=CC=C(c1ccccc1)c1ccc(N(CC)CC)cc1OC |
| InChI | InChI=1S/C21H25NO/c1-5-11-19(17-12-9-8-10-13-17)20-15-14-18(16-21(20)23-4)22(6-2)7-3/h5,8-16H,1,6-7H2,2-4H3 |
| InChIKey | KLRRAKYAYWUSIR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|