C29H32O7 — CID 10601195
methyl (E)-2-[2-[(E)-2-[(2R,4S)-5,5-dimethyl-2-(2-methylprop-1-enyl)spiro[1,3-dioxolane-4,3'-2H-1,4-benzodioxine]-6'-yl]ethenyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 10601195) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is methyl (E)-2-[2-[(E)-2-[(2R,4S)-5,5-dimethyl-2-(2-methylprop-1-enyl)spiro[1,3-dioxolane-4,3'-2H-1,4-benzodioxine]-6'-yl]ethenyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[(E)-2-[(2R,4S)-5,5-dimethyl-2-(2-methylprop-1-enyl)spiro[1,3-dioxolane-4,3'-2H-1,4-benzodioxine]-6'-yl]ethenyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 10601195 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | methyl (E)-2-[2-[(E)-2-[(2R,4S)-5,5-dimethyl-2-(2-methylprop-1-enyl)spiro[1,3-dioxolane-4,3'-2H-1,4-benzodioxine]-6'-yl]ethenyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1/C=C/c1ccc2c(c1)O[C@@]1(CO2)O[C@H](C=C(C)C)OC1(C)C |
| InChI | InChI=1S/C29H32O7/c1-19(2)15-26-35-28(3,4)29(36-26)18-33-24-14-12-20(16-25(24)34-29)11-13-21-9-7-8-10-22(21)23(17-31-5)27(30)32-6/h7-17,26H,18H2,1-6H3/b13-11+,23-17+/t26-,29+/m1/s1 |
| InChIKey | WZMWSUOORHQCPS-BJYJFZPNSA-N |
| XLogP | 5.60 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|