C31H26O6 — CID 10601266
(7R,8R)-7,8-bis(phenylmethoxymethyl)-6,9,15-trioxatetracyclo[8.6.2.05,17.014,18]octadeca-1(17),2,4,10,12,14(18)-hexaen-16-one (PubChem CID 10601266) has the molecular formula C31H26O6 and a molecular weight of 494.54 g/mol. Its IUPAC name is (7R,8R)-7,8-bis(phenylmethoxymethyl)-6,9,15-trioxatetracyclo[8.6.2.05,17.014,18]octadeca-1(17),2,4,10,12,14(18)-hexaen-16-one.
| Compound Name | (7R,8R)-7,8-bis(phenylmethoxymethyl)-6,9,15-trioxatetracyclo[8.6.2.05,17.014,18]octadeca-1(17),2,4,10,12,14(18)-hexaen-16-one |
|---|---|
| PubChem CID | 10601266 |
| Molecular Formula | C31H26O6 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (7R,8R)-7,8-bis(phenylmethoxymethyl)-6,9,15-trioxatetracyclo[8.6.2.05,17.014,18]octadeca-1(17),2,4,10,12,14(18)-hexaen-16-one |
| SMILES | O=c1oc2cccc3c2c2c(cccc12)O[C@H](COCc1ccccc1)[C@@H](COCc1ccccc1)O3 |
| InChI | InChI=1S/C31H26O6/c32-31-23-13-7-14-24-29(23)30-25(15-8-16-26(30)37-31)36-28(20-34-18-22-11-5-2-6-12-22)27(35-24)19-33-17-21-9-3-1-4-10-21/h1-16,27-28H,17-20H2/t27-,28-/m1/s1 |
| InChIKey | XCPPWASEZPAXMU-VSGBNLITSA-N |
| XLogP | 5.89 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|