C12H20ClN5 — CID 106014974
6-chloro-2-N-(3-cyclopentylpropyl)-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 106014974) has the molecular formula C12H20ClN5 and a molecular weight of 269.78 g/mol. Its IUPAC name is 6-chloro-2-N-(3-cyclopentylpropyl)-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(3-cyclopentylpropyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106014974 |
| Molecular Formula | C12H20ClN5 |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 6-chloro-2-N-(3-cyclopentylpropyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Cl)nc(NCCCC2CCCC2)n1 |
| InChI | InChI=1S/C12H20ClN5/c1-14-11-16-10(13)17-12(18-11)15-8-4-7-9-5-2-3-6-9/h9H,2-8H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | YMRNHBUGGPYETN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|