C11H18ClN5O2 — CID 110192084
6-chloro-2-N-[3-(1,3-dioxolan-2-yl)propyl]-4-N-ethyl-1,3,5-triazine-2,4-diamine (PubChem CID 110192084) has the molecular formula C11H18ClN5O2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 6-chloro-2-N-[3-(1,3-dioxolan-2-yl)propyl]-4-N-ethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[3-(1,3-dioxolan-2-yl)propyl]-4-N-ethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 110192084 |
| Molecular Formula | C11H18ClN5O2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 6-chloro-2-N-[3-(1,3-dioxolan-2-yl)propyl]-4-N-ethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Cl)nc(NCCCC2OCCO2)n1 |
| InChI | InChI=1S/C11H18ClN5O2/c1-2-13-10-15-9(12)16-11(17-10)14-5-3-4-8-18-6-7-19-8/h8H,2-7H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | HUPOCAZVGIJJAN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|