C13H25N5O2S — CID 106015942
4-(propylaminomethyl)-N-(1H-pyrazol-4-ylmethyl)piperidine-1-sulfonamide (PubChem CID 106015942) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 4-(propylaminomethyl)-N-(1H-pyrazol-4-ylmethyl)piperidine-1-sulfonamide.
| Compound Name | 4-(propylaminomethyl)-N-(1H-pyrazol-4-ylmethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106015942 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-(propylaminomethyl)-N-(1H-pyrazol-4-ylmethyl)piperidine-1-sulfonamide |
| SMILES | CCCNCC1CCN(S(=O)(=O)NCc2cn[nH]c2)CC1 |
| InChI | InChI=1S/C13H25N5O2S/c1-2-5-14-8-12-3-6-18(7-4-12)21(19,20)17-11-13-9-15-16-10-13/h9-10,12,14,17H,2-8,11H2,1H3,(H,15,16) |
| InChIKey | INWXBSYUKDQZKG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|