C13H24N4O3S — CID 106423900
N-(1,2-oxazol-5-ylmethyl)-4-(propylaminomethyl)piperidine-1-sulfonamide (PubChem CID 106423900) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-(1,2-oxazol-5-ylmethyl)-4-(propylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-(1,2-oxazol-5-ylmethyl)-4-(propylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106423900 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-(1,2-oxazol-5-ylmethyl)-4-(propylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CCCNCC1CCN(S(=O)(=O)NCc2ccno2)CC1 |
| InChI | InChI=1S/C13H24N4O3S/c1-2-6-14-10-12-4-8-17(9-5-12)21(18,19)16-11-13-3-7-15-20-13/h3,7,12,14,16H,2,4-6,8-11H2,1H3 |
| InChIKey | XUWNRTLPECKEOX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|