C10H15N3O5S — CID 114185928
1-(1,2-oxazol-5-ylmethylsulfamoyl)piperidine-2-carboxylic acid (PubChem CID 114185928) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-(1,2-oxazol-5-ylmethylsulfamoyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(1,2-oxazol-5-ylmethylsulfamoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114185928 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-(1,2-oxazol-5-ylmethylsulfamoyl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1S(=O)(=O)NCc1ccno1 |
| InChI | InChI=1S/C10H15N3O5S/c14-10(15)9-3-1-2-6-13(9)19(16,17)12-7-8-4-5-11-18-8/h4-5,9,12H,1-3,6-7H2,(H,14,15) |
| InChIKey | GSQZOPXITDFEOH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |