C11H26N4O2S — CID 114141798
N',N'-dimethyl-4-(propylaminomethyl)piperidine-1-sulfonohydrazide (PubChem CID 114141798) has the molecular formula C11H26N4O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is N',N'-dimethyl-4-(propylaminomethyl)piperidine-1-sulfonohydrazide.
| Compound Name | N',N'-dimethyl-4-(propylaminomethyl)piperidine-1-sulfonohydrazide |
|---|---|
| PubChem CID | 114141798 |
| Molecular Formula | C11H26N4O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N',N'-dimethyl-4-(propylaminomethyl)piperidine-1-sulfonohydrazide |
| SMILES | CCCNCC1CCN(S(=O)(=O)NN(C)C)CC1 |
| InChI | InChI=1S/C11H26N4O2S/c1-4-7-12-10-11-5-8-15(9-6-11)18(16,17)13-14(2)3/h11-13H,4-10H2,1-3H3 |
| InChIKey | FJWLRGMTRABWSQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|