C13H25N3O2S2 — CID 106017154
N-[2-(dimethylamino)propyl]-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide (PubChem CID 106017154) has the molecular formula C13H25N3O2S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)propyl]-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide.
| Compound Name | N-[2-(dimethylamino)propyl]-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106017154 |
| Molecular Formula | C13H25N3O2S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[2-(dimethylamino)propyl]-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
| SMILES | CC(C)NCc1cc(S(=O)(=O)NCC(C)N(C)C)cs1 |
| InChI | InChI=1S/C13H25N3O2S2/c1-10(2)14-8-12-6-13(9-19-12)20(17,18)15-7-11(3)16(4)5/h6,9-11,14-15H,7-8H2,1-5H3 |
| InChIKey | WNHIJGDTTYEERS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |