C15H30N2O2S — CID 106019116
2-(propylamino)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanesulfonamide (PubChem CID 106019116) has the molecular formula C15H30N2O2S and a molecular weight of 302.48 g/mol. Its IUPAC name is 2-(propylamino)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanesulfonamide.
| Compound Name | 2-(propylamino)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanesulfonamide |
|---|---|
| PubChem CID | 106019116 |
| Molecular Formula | C15H30N2O2S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-(propylamino)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanesulfonamide |
| SMILES | CCCNCCS(=O)(=O)NC1C2(C)CCC(C2)C1(C)C |
| InChI | InChI=1S/C15H30N2O2S/c1-5-8-16-9-10-20(18,19)17-13-14(2,3)12-6-7-15(13,4)11-12/h12-13,16-17H,5-11H2,1-4H3 |
| InChIKey | HNDKJMSJTNKDPM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|