C16H34O4Sn2 — CID 10602226
ethyl (Z)-6-(methoxymethoxy)-2,3-bis(trimethylstannyl)hex-2-enoate (PubChem CID 10602226) has the molecular formula C16H34O4Sn2 and a molecular weight of 527.87 g/mol. Its IUPAC name is ethyl (Z)-6-(methoxymethoxy)-2,3-bis(trimethylstannyl)hex-2-enoate.
| Compound Name | ethyl (Z)-6-(methoxymethoxy)-2,3-bis(trimethylstannyl)hex-2-enoate |
|---|---|
| PubChem CID | 10602226 |
| Molecular Formula | C16H34O4Sn2 |
| Molecular Weight | 527.87 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | ethyl (Z)-6-(methoxymethoxy)-2,3-bis(trimethylstannyl)hex-2-enoate |
| SMILES | CCOC(=O)/C(=C(\CCCOCOC)[Sn](C)(C)C)[Sn](C)(C)C |
| InChI | InChI=1S/C10H16O4.6CH3.2Sn/c1-3-14-10(11)7-5-4-6-8-13-9-12-2;;;;;;;;/h3-4,6,8-9H2,1-2H3;6*1H3;; |
| InChIKey | GAXZFEMNJYXHPQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|