C13H27ClO2Sn2 — CID 10672626
ethyl (E)-5-chloro-2,3-bis(trimethylstannyl)pent-2-enoate (PubChem CID 10672626) has the molecular formula C13H27ClO2Sn2 and a molecular weight of 488.23 g/mol. Its IUPAC name is ethyl (E)-5-chloro-2,3-bis(trimethylstannyl)pent-2-enoate.
| Compound Name | ethyl (E)-5-chloro-2,3-bis(trimethylstannyl)pent-2-enoate |
|---|---|
| PubChem CID | 10672626 |
| Molecular Formula | C13H27ClO2Sn2 |
| Molecular Weight | 488.23 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | ethyl (E)-5-chloro-2,3-bis(trimethylstannyl)pent-2-enoate |
| SMILES | CCOC(=O)/C(=C(/CCCl)[Sn](C)(C)C)[Sn](C)(C)C |
| InChI | InChI=1S/C7H9ClO2.6CH3.2Sn/c1-2-10-7(9)5-3-4-6-8;;;;;;;;/h2,4,6H2,1H3;6*1H3;; |
| InChIKey | LKYLFXVYTWUYDG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.23 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|