C32H41NO4S — CID 10602427
5-[7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(4-methylphenyl)sulfanylheptyl]-2-methoxyphenol (PubChem CID 10602427) has the molecular formula C32H41NO4S and a molecular weight of 535.75 g/mol. Its IUPAC name is 5-[7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(4-methylphenyl)sulfanylheptyl]-2-methoxyphenol.
| Compound Name | 5-[7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(4-methylphenyl)sulfanylheptyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 10602427 |
| Molecular Formula | C32H41NO4S |
| Molecular Weight | 535.75 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 5-[7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(4-methylphenyl)sulfanylheptyl]-2-methoxyphenol |
| SMILES | COc1ccc(C(CCCCCCN2CCc3cc(OC)c(OC)cc3C2)Sc2ccc(C)cc2)cc1O |
| InChI | InChI=1S/C32H41NO4S/c1-23-10-13-27(14-11-23)38-32(25-12-15-29(35-2)28(34)19-25)9-7-5-6-8-17-33-18-16-24-20-30(36-3)31(37-4)21-26(24)22-33/h10-15,19-21,32,34H,5-9,16-18,22H2,1-4H3 |
| InChIKey | HNNRIVDZVTZPSR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.75 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|