C34H42N2O4S — CID 67694052
8-[1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-(4-methylphenyl)sulfanyloctanenitrile (PubChem CID 67694052) has the molecular formula C34H42N2O4S and a molecular weight of 574.79 g/mol. Its IUPAC name is 8-[1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-(4-methylphenyl)sulfanyloctanenitrile.
| Compound Name | 8-[1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-(4-methylphenyl)sulfanyloctanenitrile |
|---|---|
| PubChem CID | 67694052 |
| Molecular Formula | C34H42N2O4S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 8-[1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-(4-methylphenyl)sulfanyloctanenitrile |
| SMILES | COc1ccc(C2c3cc(OC)c(OC)cc3CCN2CCCCCCC(C#N)Sc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C34H42N2O4S/c1-24-11-14-27(15-12-24)41-28(23-35)10-8-6-7-9-18-36-19-17-25-20-32(39-4)33(40-5)22-29(25)34(36)26-13-16-30(37-2)31(21-26)38-3/h11-16,20-22,28,34H,6-10,17-19H2,1-5H3 |
| InChIKey | RGSOCWCUPDRPOQ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|