C29H29N7O5S — CID 10603443
2-[[3-[[4-[(2-azidophenyl)sulfonylcarbamoyl]phenyl]methyl]-2-butylimidazol-4-yl]methylamino]benzoic acid (PubChem CID 10603443) has the molecular formula C29H29N7O5S and a molecular weight of 587.66 g/mol. Its IUPAC name is 2-[[3-[[4-[(2-azidophenyl)sulfonylcarbamoyl]phenyl]methyl]-2-butylimidazol-4-yl]methylamino]benzoic acid.
| Compound Name | 2-[[3-[[4-[(2-azidophenyl)sulfonylcarbamoyl]phenyl]methyl]-2-butylimidazol-4-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 10603443 |
| Molecular Formula | C29H29N7O5S |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | 2-[[3-[[4-[(2-azidophenyl)sulfonylcarbamoyl]phenyl]methyl]-2-butylimidazol-4-yl]methylamino]benzoic acid |
| SMILES | CCCCc1ncc(CNc2ccccc2C(=O)O)n1Cc1ccc(C(=O)NS(=O)(=O)c2ccccc2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C29H29N7O5S/c1-2-3-12-27-32-18-22(17-31-24-9-5-4-8-23(24)29(38)39)36(27)19-20-13-15-21(16-14-20)28(37)34-42(40,41)26-11-7-6-10-25(26)33-35-30/h4-11,13-16,18,31H,2-3,12,17,19H2,1H3,(H,34,37)(H,38,39) |
| InChIKey | SKTCIXGMPLITJZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 179.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|