C34H43N7O3 — CID 10603613
N-ethyl-N-[2-[[4-(4-ethylpiperazin-1-yl)phenyl]methyl-methylamino]ethyl]-4-oxo-4-(6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepin-11-yl)butanamide (PubChem CID 10603613) has the molecular formula C34H43N7O3 and a molecular weight of 597.76 g/mol. Its IUPAC name is N-ethyl-N-[2-[[4-(4-ethylpiperazin-1-yl)phenyl]methyl-methylamino]ethyl]-4-oxo-4-(6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepin-11-yl)butanamide.
| Compound Name | N-ethyl-N-[2-[[4-(4-ethylpiperazin-1-yl)phenyl]methyl-methylamino]ethyl]-4-oxo-4-(6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepin-11-yl)butanamide |
|---|---|
| PubChem CID | 10603613 |
| Molecular Formula | C34H43N7O3 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.34 |
| IUPAC Name | N-ethyl-N-[2-[[4-(4-ethylpiperazin-1-yl)phenyl]methyl-methylamino]ethyl]-4-oxo-4-(6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepin-11-yl)butanamide |
| SMILES | CCN1CCN(c2ccc(CN(C)CCN(CC)C(=O)CCC(=O)N3c4ccccc4C(=O)Nc4cccnc43)cc2)CC1 |
| InChI | InChI=1S/C34H43N7O3/c1-4-38-20-23-40(24-21-38)27-14-12-26(13-15-27)25-37(3)19-22-39(5-2)31(42)16-17-32(43)41-30-11-7-6-9-28(30)34(44)36-29-10-8-18-35-33(29)41/h6-15,18H,4-5,16-17,19-25H2,1-3H3,(H,36,44) |
| InChIKey | HYBNIEDOZATWDF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|