C13H14ClN5OS — CID 106037250
4-[2-[8-(chloromethyl)-6-methoxypurin-9-yl]ethyl]-2-methyl-1,3-thiazole (PubChem CID 106037250) has the molecular formula C13H14ClN5OS and a molecular weight of 323.81 g/mol. Its IUPAC name is 4-[2-[8-(chloromethyl)-6-methoxypurin-9-yl]ethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[2-[8-(chloromethyl)-6-methoxypurin-9-yl]ethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 106037250 |
| Molecular Formula | C13H14ClN5OS |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-[2-[8-(chloromethyl)-6-methoxypurin-9-yl]ethyl]-2-methyl-1,3-thiazole |
| SMILES | COc1ncnc2c1nc(CCl)n2CCc1csc(C)n1 |
| InChI | InChI=1S/C13H14ClN5OS/c1-8-17-9(6-21-8)3-4-19-10(5-14)18-11-12(19)15-7-16-13(11)20-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | MKXYABBWDRGKDV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|