C13H19ClN4O — CID 113457936
8-(chloromethyl)-9-(3,3-dimethylbutan-2-yl)-6-methoxypurine (PubChem CID 113457936) has the molecular formula C13H19ClN4O and a molecular weight of 282.77 g/mol. Its IUPAC name is 8-(chloromethyl)-9-(3,3-dimethylbutan-2-yl)-6-methoxypurine.
| Compound Name | 8-(chloromethyl)-9-(3,3-dimethylbutan-2-yl)-6-methoxypurine |
|---|---|
| PubChem CID | 113457936 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 8-(chloromethyl)-9-(3,3-dimethylbutan-2-yl)-6-methoxypurine |
| SMILES | COc1ncnc2c1nc(CCl)n2C(C)C(C)(C)C |
| InChI | InChI=1S/C13H19ClN4O/c1-8(13(2,3)4)18-9(6-14)17-10-11(18)15-7-16-12(10)19-5/h7-8H,6H2,1-5H3 |
| InChIKey | MQGOUAOPZMTNLC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|