C10H14N6 — CID 106040838
2-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyrazine-2,5-diamine (PubChem CID 106040838) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyrazine-2,5-diamine.
| Compound Name | 2-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyrazine-2,5-diamine |
|---|---|
| PubChem CID | 106040838 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyrazine-2,5-diamine |
| SMILES | Cc1c(CNc2cnc(N)cn2)cnn1C |
| InChI | InChI=1S/C10H14N6/c1-7-8(4-15-16(7)2)3-13-10-6-12-9(11)5-14-10/h4-6H,3H2,1-2H3,(H2,11,12)(H,13,14) |
| InChIKey | DOKQXDIXBYEVTE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |