C14H27N5 — CID 106042113
2-N-ethyl-5-methyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]pyrimidine-2,4-diamine (PubChem CID 106042113) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-N-ethyl-5-methyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-ethyl-5-methyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106042113 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | 2-N-ethyl-5-methyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]pyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(C)c(NCCCN(C)C(C)C)n1 |
| InChI | InChI=1S/C14H27N5/c1-6-15-14-17-10-12(4)13(18-14)16-8-7-9-19(5)11(2)3/h10-11H,6-9H2,1-5H3,(H2,15,16,17,18) |
| InChIKey | FYKJOHCZLRRMDU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|