C13H20N6OS — CID 106043508
2-(ethoxymethyl)-6-hydrazinyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine (PubChem CID 106043508) has the molecular formula C13H20N6OS and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-(ethoxymethyl)-6-hydrazinyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-(ethoxymethyl)-6-hydrazinyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106043508 |
| Molecular Formula | C13H20N6OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(ethoxymethyl)-6-hydrazinyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine |
| SMILES | CCOCc1nc(NN)cc(NCCc2csc(C)n2)n1 |
| InChI | InChI=1S/C13H20N6OS/c1-3-20-7-13-17-11(6-12(18-13)19-14)15-5-4-10-8-21-9(2)16-10/h6,8H,3-5,7,14H2,1-2H3,(H2,15,17,18,19) |
| InChIKey | MNWBJENFZJCWSA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|