C15H18ClN3OS — CID 106050385
N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(propylamino)pyridine-4-carboxamide (PubChem CID 106050385) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(propylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106050385 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cnccc1C(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-2-7-18-13-10-17-8-6-12(13)15(20)19-9-5-11-3-4-14(16)21-11/h3-4,6,8,10,18H,2,5,7,9H2,1H3,(H,19,20) |
| InChIKey | QNUIFIUORJLYOH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |