C14H16ClN3OS — CID 106050398
N-[2-(5-chlorothiophen-2-yl)ethyl]-4-(ethylamino)pyridine-3-carboxamide (PubChem CID 106050398) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-4-(ethylamino)pyridine-3-carboxamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-4-(ethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106050398 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-4-(ethylamino)pyridine-3-carboxamide |
| SMILES | CCNc1ccncc1C(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H16ClN3OS/c1-2-17-12-6-7-16-9-11(12)14(19)18-8-5-10-3-4-13(15)20-10/h3-4,6-7,9H,2,5,8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | WQNFXRIOIRTARS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |