C11H18N6O2S2 — CID 106051299
4-[(propan-2-ylamino)methyl]-N-[1-(2H-tetrazol-5-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 106051299) has the molecular formula C11H18N6O2S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 4-[(propan-2-ylamino)methyl]-N-[1-(2H-tetrazol-5-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 4-[(propan-2-ylamino)methyl]-N-[1-(2H-tetrazol-5-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106051299 |
| Molecular Formula | C11H18N6O2S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-[(propan-2-ylamino)methyl]-N-[1-(2H-tetrazol-5-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CC(C)NCc1csc(S(=O)(=O)NC(C)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C11H18N6O2S2/c1-7(2)12-5-9-4-10(20-6-9)21(18,19)15-8(3)11-13-16-17-14-11/h4,6-8,12,15H,5H2,1-3H3,(H,13,14,16,17) |
| InChIKey | OWLCPBBCWHUNNC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |