C9H10BrFN6O2S — CID 106051560
3-(aminomethyl)-5-bromo-2-fluoro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide (PubChem CID 106051560) has the molecular formula C9H10BrFN6O2S and a molecular weight of 365.19 g/mol. Its IUPAC name is 3-(aminomethyl)-5-bromo-2-fluoro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-5-bromo-2-fluoro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106051560 |
| Molecular Formula | C9H10BrFN6O2S |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 3-(aminomethyl)-5-bromo-2-fluoro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
| SMILES | NCc1cc(Br)cc(S(=O)(=O)NCc2nn[nH]n2)c1F |
| InChI | InChI=1S/C9H10BrFN6O2S/c10-6-1-5(3-12)9(11)7(2-6)20(18,19)13-4-8-14-16-17-15-8/h1-2,13H,3-4,12H2,(H,14,15,16,17) |
| InChIKey | JSBNIVTWSRPNHR-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |