C12H18BrFN2O2S2 — CID 106080886
3-(aminomethyl)-5-bromo-2-fluoro-N-(2-methyl-2-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 106080886) has the molecular formula C12H18BrFN2O2S2 and a molecular weight of 385.32 g/mol. Its IUPAC name is 3-(aminomethyl)-5-bromo-2-fluoro-N-(2-methyl-2-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-5-bromo-2-fluoro-N-(2-methyl-2-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106080886 |
| Molecular Formula | C12H18BrFN2O2S2 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 3-(aminomethyl)-5-bromo-2-fluoro-N-(2-methyl-2-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CSC(C)(C)CNS(=O)(=O)c1cc(Br)cc(CN)c1F |
| InChI | InChI=1S/C12H18BrFN2O2S2/c1-12(2,19-3)7-16-20(17,18)10-5-9(13)4-8(6-15)11(10)14/h4-5,16H,6-7,15H2,1-3H3 |
| InChIKey | VUYMGIBVSTYIDD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |