C37H30F5N7O7 — CID 10605262
(2,3,4,5,6-pentafluorophenyl) (2R,4R)-4-[2-amino-1-(2-methylpropanoyl)-6-oxopurin-9-yl]-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate (PubChem CID 10605262) has the molecular formula C37H30F5N7O7 and a molecular weight of 779.68 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2R,4R)-4-[2-amino-1-(2-methylpropanoyl)-6-oxopurin-9-yl]-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2R,4R)-4-[2-amino-1-(2-methylpropanoyl)-6-oxopurin-9-yl]-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10605262 |
| Molecular Formula | C37H30F5N7O7 |
| Molecular Weight | 779.68 g/mol |
| Exact Mass | 779.21 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2R,4R)-4-[2-amino-1-(2-methylpropanoyl)-6-oxopurin-9-yl]-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)C(=O)n1c(N)nc2c(ncn2[C@@H]2C[C@H](C(=O)Oc3c(F)c(F)c(F)c(F)c3F)N(C(=O)CNC(=O)OCC3c4ccccc4-c4ccccc43)C2)c1=O |
| InChI | InChI=1S/C37H30F5N7O7/c1-16(2)33(51)49-34(52)30-32(46-36(49)43)48(15-45-30)17-11-23(35(53)56-31-28(41)26(39)25(38)27(40)29(31)42)47(13-17)24(50)12-44-37(54)55-14-22-20-9-5-3-7-18(20)19-8-4-6-10-21(19)22/h3-10,15-17,22-23H,11-14H2,1-2H3,(H2,43,46)(H,44,54)/t17-,23-/m1/s1 |
| InChIKey | IJEBFUODIHERFH-UZUQRXQVSA-N |
| XLogP | 4.45 |
| TPSA | 180.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|