C11H20N2O2S2 — CID 106053228
3-(methylamino)-N-(1-thiophen-3-ylpropan-2-yl)propane-1-sulfonamide (PubChem CID 106053228) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 3-(methylamino)-N-(1-thiophen-3-ylpropan-2-yl)propane-1-sulfonamide.
| Compound Name | 3-(methylamino)-N-(1-thiophen-3-ylpropan-2-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106053228 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-(methylamino)-N-(1-thiophen-3-ylpropan-2-yl)propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)NC(C)Cc1ccsc1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-10(8-11-4-6-16-9-11)13-17(14,15)7-3-5-12-2/h4,6,9-10,12-13H,3,5,7-8H2,1-2H3 |
| InChIKey | ZPXDLBSWBZPUKE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|