C13H22N2O2S2 — CID 106053417
1-(cyclopropylamino)-N-(1-thiophen-2-ylpropyl)propane-2-sulfonamide (PubChem CID 106053417) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-(cyclopropylamino)-N-(1-thiophen-2-ylpropyl)propane-2-sulfonamide.
| Compound Name | 1-(cyclopropylamino)-N-(1-thiophen-2-ylpropyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106053417 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-(cyclopropylamino)-N-(1-thiophen-2-ylpropyl)propane-2-sulfonamide |
| SMILES | CCC(NS(=O)(=O)C(C)CNC1CC1)c1cccs1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-3-12(13-5-4-8-18-13)15-19(16,17)10(2)9-14-11-6-7-11/h4-5,8,10-12,14-15H,3,6-7,9H2,1-2H3 |
| InChIKey | DAFIJBVVYSASPU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |