C12H22N4O2S2 — CID 106053665
4-cyclopropyl-2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,3-thiazole (PubChem CID 106053665) has the molecular formula C12H22N4O2S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 4-cyclopropyl-2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,3-thiazole.
| Compound Name | 4-cyclopropyl-2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,3-thiazole |
|---|---|
| PubChem CID | 106053665 |
| Molecular Formula | C12H22N4O2S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-cyclopropyl-2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,3-thiazole |
| SMILES | CCNCCCN(C)S(=O)(=O)Nc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C12H22N4O2S2/c1-3-13-7-4-8-16(2)20(17,18)15-12-14-11(9-19-12)10-5-6-10/h9-10,13H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | NLMRLWFSDNGZOH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|