C12H22N6S2 — CID 88721654
1-[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-4-methylpentyl]-3-methylthiourea (PubChem CID 88721654) has the molecular formula C12H22N6S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 1-[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-4-methylpentyl]-3-methylthiourea.
| Compound Name | 1-[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-4-methylpentyl]-3-methylthiourea |
|---|---|
| PubChem CID | 88721654 |
| Molecular Formula | C12H22N6S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-4-methylpentyl]-3-methylthiourea |
| SMILES | CNC(=S)NCCCC(C)Cc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C12H22N6S2/c1-8(4-3-5-16-11(19)15-2)6-9-7-20-12(17-9)18-10(13)14/h7-8H,3-6H2,1-2H3,(H2,15,16,19)(H4,13,14,17,18) |
| InChIKey | MDSMKSTVSXBQBJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|