C13H22ClN3O3S — CID 106056423
5-(aminomethyl)-2-chloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide (PubChem CID 106056423) has the molecular formula C13H22ClN3O3S and a molecular weight of 335.86 g/mol. Its IUPAC name is 5-(aminomethyl)-2-chloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2-chloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106056423 |
| Molecular Formula | C13H22ClN3O3S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-(aminomethyl)-2-chloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide |
| SMILES | COCCN(C)CCNS(=O)(=O)c1cc(CN)ccc1Cl |
| InChI | InChI=1S/C13H22ClN3O3S/c1-17(7-8-20-2)6-5-16-21(18,19)13-9-11(10-15)3-4-12(13)14/h3-4,9,16H,5-8,10,15H2,1-2H3 |
| InChIKey | WVSSKFKNCSURGM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |