C11H17BrN4O2S — CID 106062105
4-(aminomethyl)-N-(3-bromo-2-pyridinyl)piperidine-1-sulfonamide (PubChem CID 106062105) has the molecular formula C11H17BrN4O2S and a molecular weight of 349.25 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(3-bromo-2-pyridinyl)piperidine-1-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(3-bromo-2-pyridinyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106062105 |
| Molecular Formula | C11H17BrN4O2S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-(aminomethyl)-N-(3-bromo-2-pyridinyl)piperidine-1-sulfonamide |
| SMILES | NCC1CCN(S(=O)(=O)Nc2ncccc2Br)CC1 |
| InChI | InChI=1S/C11H17BrN4O2S/c12-10-2-1-5-14-11(10)15-19(17,18)16-6-3-9(8-13)4-7-16/h1-2,5,9H,3-4,6-8,13H2,(H,14,15) |
| InChIKey | DZAGOIITYSPMQY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |