C12H16BrF2N3O2S — CID 106088800
4-(aminomethyl)-N-(4-bromo-2,5-difluorophenyl)piperidine-1-sulfonamide (PubChem CID 106088800) has the molecular formula C12H16BrF2N3O2S and a molecular weight of 384.25 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(4-bromo-2,5-difluorophenyl)piperidine-1-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(4-bromo-2,5-difluorophenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106088800 |
| Molecular Formula | C12H16BrF2N3O2S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 4-(aminomethyl)-N-(4-bromo-2,5-difluorophenyl)piperidine-1-sulfonamide |
| SMILES | NCC1CCN(S(=O)(=O)Nc2cc(F)c(Br)cc2F)CC1 |
| InChI | InChI=1S/C12H16BrF2N3O2S/c13-9-5-11(15)12(6-10(9)14)17-21(19,20)18-3-1-8(7-16)2-4-18/h5-6,8,17H,1-4,7,16H2 |
| InChIKey | XRZHAKSAYHZWGM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|