C12H25N5O2S — CID 106064153
N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-4-(propylamino)butane-1-sulfonamide (PubChem CID 106064153) has the molecular formula C12H25N5O2S and a molecular weight of 303.43 g/mol. Its IUPAC name is N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-4-(propylamino)butane-1-sulfonamide.
| Compound Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-4-(propylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106064153 |
| Molecular Formula | C12H25N5O2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-4-(propylamino)butane-1-sulfonamide |
| SMILES | CCCNCCCCS(=O)(=O)NCCc1nncn1C |
| InChI | InChI=1S/C12H25N5O2S/c1-3-7-13-8-4-5-10-20(18,19)15-9-6-12-16-14-11-17(12)2/h11,13,15H,3-10H2,1-2H3 |
| InChIKey | YDXUXMBTFDCOIC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|