C17H28O3 — CID 10606623
[(6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-1,6-dien-3-yl] acetate (PubChem CID 10606623) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-1,6-dien-3-yl] acetate.
| Compound Name | [(6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-1,6-dien-3-yl] acetate |
|---|---|
| PubChem CID | 10606623 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-1,6-dien-3-yl] acetate |
| SMILES | C=CC(C)(CC/C=C(\C)CCC1OC1(C)C)OC(C)=O |
| InChI | InChI=1S/C17H28O3/c1-7-17(6,19-14(3)18)12-8-9-13(2)10-11-15-16(4,5)20-15/h7,9,15H,1,8,10-12H2,2-6H3/b13-9+ |
| InChIKey | DVBQYRPKDQUXTQ-UKTHLTGXSA-N |
| XLogP | 4.18 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|