C13H31N5O2S — CID 106066888
2-[[[3-(ethylamino)propyl-methylsulfamoyl]amino]methyl]-1,4-dimethylpiperazine (PubChem CID 106066888) has the molecular formula C13H31N5O2S and a molecular weight of 321.49 g/mol. Its IUPAC name is 2-[[[3-(ethylamino)propyl-methylsulfamoyl]amino]methyl]-1,4-dimethylpiperazine.
| Compound Name | 2-[[[3-(ethylamino)propyl-methylsulfamoyl]amino]methyl]-1,4-dimethylpiperazine |
|---|---|
| PubChem CID | 106066888 |
| Molecular Formula | C13H31N5O2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2-[[[3-(ethylamino)propyl-methylsulfamoyl]amino]methyl]-1,4-dimethylpiperazine |
| SMILES | CCNCCCN(C)S(=O)(=O)NCC1CN(C)CCN1C |
| InChI | InChI=1S/C13H31N5O2S/c1-5-14-7-6-8-18(4)21(19,20)15-11-13-12-16(2)9-10-17(13)3/h13-15H,5-12H2,1-4H3 |
| InChIKey | LEPXMBKVZGALSW-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|