C11H25N3O4S2 — CID 106016855
3-[[[3-(ethylamino)propyl-methylsulfamoyl]amino]methyl]-1,1-dioxothiolane (PubChem CID 106016855) has the molecular formula C11H25N3O4S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 3-[[[3-(ethylamino)propyl-methylsulfamoyl]amino]methyl]-1,1-dioxothiolane.
| Compound Name | 3-[[[3-(ethylamino)propyl-methylsulfamoyl]amino]methyl]-1,1-dioxothiolane |
|---|---|
| PubChem CID | 106016855 |
| Molecular Formula | C11H25N3O4S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-[[[3-(ethylamino)propyl-methylsulfamoyl]amino]methyl]-1,1-dioxothiolane |
| SMILES | CCNCCCN(C)S(=O)(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H25N3O4S2/c1-3-12-6-4-7-14(2)20(17,18)13-9-11-5-8-19(15,16)10-11/h11-13H,3-10H2,1-2H3 |
| InChIKey | FAKMTNPHZSPKOF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|