C13H28N2O2S — CID 106069157
N-(2,3-dimethylcyclopentyl)-1-(propylamino)propane-2-sulfonamide (PubChem CID 106069157) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is N-(2,3-dimethylcyclopentyl)-1-(propylamino)propane-2-sulfonamide.
| Compound Name | N-(2,3-dimethylcyclopentyl)-1-(propylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106069157 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | N-(2,3-dimethylcyclopentyl)-1-(propylamino)propane-2-sulfonamide |
| SMILES | CCCNCC(C)S(=O)(=O)NC1CCC(C)C1C |
| InChI | InChI=1S/C13H28N2O2S/c1-5-8-14-9-11(3)18(16,17)15-13-7-6-10(2)12(13)4/h10-15H,5-9H2,1-4H3 |
| InChIKey | RYJWYWWVGCTCBX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|