About 3-oxoprop-1-en-2-yl propan-2-yl carbonate
3-oxoprop-1-en-2-yl propan-2-yl carbonate (PubChem CID 10607027) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is 3-oxoprop-1-en-2-yl propan-2-yl carbonate.
Molecular Properties
| Compound Name | 3-oxoprop-1-en-2-yl propan-2-yl carbonate |
| PubChem CID | 10607027 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 3-oxoprop-1-en-2-yl propan-2-yl carbonate |
| SMILES | C=C(C=O)OC(=O)OC(C)C |
| InChI | InChI=1S/C7H10O4/c1-5(2)10-7(9)11-6(3)4-8/h4-5H,3H2,1-2H3 |
| InChIKey | JTMGIQXWBKTBPO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxoprop-1-en-2-yl propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxoprop-1-en-2-yl propan-2-yl carbonate?
The IUPAC name of 3-oxoprop-1-en-2-yl propan-2-yl carbonate (CID 10607027) is 3-oxoprop-1-en-2-yl propan-2-yl carbonate.
What is the SMILES notation for 3-oxoprop-1-en-2-yl propan-2-yl carbonate?
The canonical SMILES for 3-oxoprop-1-en-2-yl propan-2-yl carbonate is C=C(C=O)OC(=O)OC(C)C.
What is the InChIKey of 3-oxoprop-1-en-2-yl propan-2-yl carbonate?
The InChIKey is JTMGIQXWBKTBPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-5(2)10-7(9)11-6(3)4-8/h4-5H,3H2,1-2H3.
What are the key properties of 3-oxoprop-1-en-2-yl propan-2-yl carbonate?
3-oxoprop-1-en-2-yl propan-2-yl carbonate has a molecular weight of 158.15 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxoprop-1-en-2-yl propan-2-yl carbonate is sourced from PubChem (CID 10607027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).