About carbonoperoxoyloxy propan-2-yl carbonate
carbonoperoxoyloxy propan-2-yl carbonate (PubChem CID 146240336) has the molecular formula C5H8O7
and a molecular weight of 180.11 g/mol. Its IUPAC name is carbonoperoxoyloxy propan-2-yl carbonate.
Molecular Properties
| Compound Name | carbonoperoxoyloxy propan-2-yl carbonate |
| PubChem CID | 146240336 |
| Molecular Formula | C5H8O7 |
| Molecular Weight | 180.11 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | carbonoperoxoyloxy propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OOC(=O)OO |
| InChI | InChI=1S/C5H8O7/c1-3(2)9-4(6)11-12-5(7)10-8/h3,8H,1-2H3 |
| InChIKey | FRIPOOAGVUTRPB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.11 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carbonoperoxoyloxy propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonoperoxoyloxy propan-2-yl carbonate?
The IUPAC name of carbonoperoxoyloxy propan-2-yl carbonate (CID 146240336) is carbonoperoxoyloxy propan-2-yl carbonate.
What is the SMILES notation for carbonoperoxoyloxy propan-2-yl carbonate?
The canonical SMILES for carbonoperoxoyloxy propan-2-yl carbonate is CC(C)OC(=O)OOC(=O)OO.
What is the InChIKey of carbonoperoxoyloxy propan-2-yl carbonate?
The InChIKey is FRIPOOAGVUTRPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O7/c1-3(2)9-4(6)11-12-5(7)10-8/h3,8H,1-2H3.
What are the key properties of carbonoperoxoyloxy propan-2-yl carbonate?
carbonoperoxoyloxy propan-2-yl carbonate has a molecular weight of 180.11 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for carbonoperoxoyloxy propan-2-yl carbonate is sourced from PubChem (CID 146240336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).