C13H22O7 — CID 88610721
propan-2-yloxycarbonyl 2-(2,3-dimethylbutan-2-ylperoxy)prop-2-eneperoxoate (PubChem CID 88610721) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is propan-2-yloxycarbonyl 2-(2,3-dimethylbutan-2-ylperoxy)prop-2-eneperoxoate.
| Compound Name | propan-2-yloxycarbonyl 2-(2,3-dimethylbutan-2-ylperoxy)prop-2-eneperoxoate |
|---|---|
| PubChem CID | 88610721 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | propan-2-yloxycarbonyl 2-(2,3-dimethylbutan-2-ylperoxy)prop-2-eneperoxoate |
| SMILES | C=C(OOC(C)(C)C(C)C)C(=O)OOC(=O)OC(C)C |
| InChI | InChI=1S/C13H22O7/c1-8(2)13(6,7)20-17-10(5)11(14)18-19-12(15)16-9(3)4/h8-9H,5H2,1-4,6-7H3 |
| InChIKey | KWNFLEDQNFPCLZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|