C15H26O9 — CID 175073229
1-[1-(1-carboxyoxyethoxy)ethoxy]ethyl 2-(2-methylbutan-2-ylperoxy)prop-2-enoate (PubChem CID 175073229) has the molecular formula C15H26O9 and a molecular weight of 350.36 g/mol. Its IUPAC name is 1-[1-(1-carboxyoxyethoxy)ethoxy]ethyl 2-(2-methylbutan-2-ylperoxy)prop-2-enoate.
| Compound Name | 1-[1-(1-carboxyoxyethoxy)ethoxy]ethyl 2-(2-methylbutan-2-ylperoxy)prop-2-enoate |
|---|---|
| PubChem CID | 175073229 |
| Molecular Formula | C15H26O9 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-[1-(1-carboxyoxyethoxy)ethoxy]ethyl 2-(2-methylbutan-2-ylperoxy)prop-2-enoate |
| SMILES | C=C(OOC(C)(C)CC)C(=O)OC(C)OC(C)OC(C)OC(=O)O |
| InChI | InChI=1S/C15H26O9/c1-8-15(6,7)24-23-9(2)13(16)21-11(4)19-10(3)20-12(5)22-14(17)18/h10-12H,2,8H2,1,3-7H3,(H,17,18) |
| InChIKey | NPKPVYNTFUEMNI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|