C16H27O8- — CID 18372104
1-[1-[2-(2,4,4-trimethylpentan-2-ylperoxy)prop-2-enoyloxy]ethoxy]ethyl carbonate (PubChem CID 18372104) has the molecular formula C16H27O8- and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-[1-[2-(2,4,4-trimethylpentan-2-ylperoxy)prop-2-enoyloxy]ethoxy]ethyl carbonate.
| Compound Name | 1-[1-[2-(2,4,4-trimethylpentan-2-ylperoxy)prop-2-enoyloxy]ethoxy]ethyl carbonate |
|---|---|
| PubChem CID | 18372104 |
| Molecular Formula | C16H27O8- |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-[1-[2-(2,4,4-trimethylpentan-2-ylperoxy)prop-2-enoyloxy]ethoxy]ethyl carbonate |
| SMILES | C=C(OOC(C)(C)CC(C)(C)C)C(=O)OC(C)OC(C)OC(=O)[O-] |
| InChI | InChI=1S/C16H28O8/c1-10(23-24-16(7,8)9-15(4,5)6)13(17)21-11(2)20-12(3)22-14(18)19/h11-12H,1,9H2,2-8H3,(H,18,19)/p-1 |
| InChIKey | OXVXSHDJCBSKGU-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|