C23H38O11 — CID 88506135
1-[1-[(E)-2-methyl-3-(2-methylbutan-2-ylperoxy)prop-2-enoyl]oxyethoxycarbonyloxy]ethyl (E)-2-methyl-3-(2-methylbutan-2-ylperoxy)prop-2-enoate (PubChem CID 88506135) has the molecular formula C23H38O11 and a molecular weight of 490.55 g/mol. Its IUPAC name is 1-[1-[(E)-2-methyl-3-(2-methylbutan-2-ylperoxy)prop-2-enoyl]oxyethoxycarbonyloxy]ethyl (E)-2-methyl-3-(2-methylbutan-2-ylperoxy)prop-2-enoate.
| Compound Name | 1-[1-[(E)-2-methyl-3-(2-methylbutan-2-ylperoxy)prop-2-enoyl]oxyethoxycarbonyloxy]ethyl (E)-2-methyl-3-(2-methylbutan-2-ylperoxy)prop-2-enoate |
|---|---|
| PubChem CID | 88506135 |
| Molecular Formula | C23H38O11 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 1-[1-[(E)-2-methyl-3-(2-methylbutan-2-ylperoxy)prop-2-enoyl]oxyethoxycarbonyloxy]ethyl (E)-2-methyl-3-(2-methylbutan-2-ylperoxy)prop-2-enoate |
| SMILES | CCC(C)(C)OO/C=C(\C)C(=O)OC(C)OC(=O)OC(C)OC(=O)/C(C)=C/OOC(C)(C)CC |
| InChI | InChI=1S/C23H38O11/c1-11-22(7,8)33-27-13-15(3)19(24)29-17(5)31-21(26)32-18(6)30-20(25)16(4)14-28-34-23(9,10)12-2/h13-14,17-18H,11-12H2,1-10H3/b15-13+,16-14+ |
| InChIKey | OMSORZPXOAVJMH-WXUKJITCSA-N |
| XLogP | 5.00 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|