C10H16O7 — CID 173078682
carboxyoxymethyl 3-tert-butylperoxy-2-methylprop-2-enoate (PubChem CID 173078682) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is carboxyoxymethyl 3-tert-butylperoxy-2-methylprop-2-enoate.
| Compound Name | carboxyoxymethyl 3-tert-butylperoxy-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173078682 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | carboxyoxymethyl 3-tert-butylperoxy-2-methylprop-2-enoate |
| SMILES | CC(=COOC(C)(C)C)C(=O)OCOC(=O)O |
| InChI | InChI=1S/C10H16O7/c1-7(5-16-17-10(2,3)4)8(11)14-6-15-9(12)13/h5H,6H2,1-4H3,(H,12,13) |
| InChIKey | HJAZQRQKMMESKX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|