C41H74O19 — CID 54536843
bis[2,2-bis(2,3-dimethylbutan-2-ylperoxycarbonyloxymethyl)butyl] carbonate (PubChem CID 54536843) has the molecular formula C41H74O19 and a molecular weight of 871.02 g/mol. Its IUPAC name is bis[2,2-bis(2,3-dimethylbutan-2-ylperoxycarbonyloxymethyl)butyl] carbonate.
| Compound Name | bis[2,2-bis(2,3-dimethylbutan-2-ylperoxycarbonyloxymethyl)butyl] carbonate |
|---|---|
| PubChem CID | 54536843 |
| Molecular Formula | C41H74O19 |
| Molecular Weight | 871.02 g/mol |
| Exact Mass | 870.48 |
| IUPAC Name | bis[2,2-bis(2,3-dimethylbutan-2-ylperoxycarbonyloxymethyl)butyl] carbonate |
| SMILES | CCC(COC(=O)OCC(CC)(COC(=O)OOC(C)(C)C(C)C)COC(=O)OOC(C)(C)C(C)C)(COC(=O)OOC(C)(C)C(C)C)COC(=O)OOC(C)(C)C(C)C |
| InChI | InChI=1S/C41H74O19/c1-19-40(23-49-32(43)53-57-36(11,12)27(3)4,24-50-33(44)54-58-37(13,14)28(5)6)21-47-31(42)48-22-41(20-2,25-51-34(45)55-59-38(15,16)29(7)8)26-52-35(46)56-60-39(17,18)30(9)10/h27-30H,19-26H2,1-18H3 |
| InChIKey | ZAJNNBXKZMQWSH-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 214.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.02 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|